C18H28O4 — CID 134979581
(2R,8R,8aS)-8,8a-dimethyl-2-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane] (PubChem CID 134979581) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is (2R,8R,8aS)-8,8a-dimethyl-2-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane].
| Compound Name | (2R,8R,8aS)-8,8a-dimethyl-2-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 134979581 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | (2R,8R,8aS)-8,8a-dimethyl-2-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,3,5,7,8-hexahydronaphthalene-6,2'-1,3-dioxolane] |
| SMILES | C[C@@H]1CC2(CC3=CC[C@@H](C4(C)OCCO4)C[C@]31C)OCCO2 |
| InChI | InChI=1S/C18H28O4/c1-13-10-18(21-8-9-22-18)12-14-4-5-15(11-16(13,14)2)17(3)19-6-7-20-17/h4,13,15H,5-12H2,1-3H3/t13-,15-,16+/m1/s1 |
| InChIKey | SEIJKRAFTMQRMB-BMFZPTHFSA-N |
| XLogP | 3.27 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|