C24H38O4 — CID 134840694
(7R,8S)-7-ethenyl-7-methyl-8-[(3E)-4-[2-(2-methyl-1,3-dioxan-2-yl)ethyl]hexa-3,5-dienyl]-1,4-dioxaspiro[4.5]decane (PubChem CID 134840694) has the molecular formula C24H38O4 and a molecular weight of 390.56 g/mol. Its IUPAC name is (7R,8S)-7-ethenyl-7-methyl-8-[(3E)-4-[2-(2-methyl-1,3-dioxan-2-yl)ethyl]hexa-3,5-dienyl]-1,4-dioxaspiro[4.5]decane.
| Compound Name | (7R,8S)-7-ethenyl-7-methyl-8-[(3E)-4-[2-(2-methyl-1,3-dioxan-2-yl)ethyl]hexa-3,5-dienyl]-1,4-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134840694 |
| Molecular Formula | C24H38O4 |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | (7R,8S)-7-ethenyl-7-methyl-8-[(3E)-4-[2-(2-methyl-1,3-dioxan-2-yl)ethyl]hexa-3,5-dienyl]-1,4-dioxaspiro[4.5]decane |
| SMILES | C=C/C(=C/CC[C@H]1CCC2(C[C@]1(C)C=C)OCCO2)CCC1(C)OCCCO1 |
| InChI | InChI=1S/C24H38O4/c1-5-20(11-13-23(4)25-15-8-16-26-23)9-7-10-21-12-14-24(27-17-18-28-24)19-22(21,3)6-2/h5-6,9,21H,1-2,7-8,10-19H2,3-4H3/b20-9-/t21-,22-/m0/s1 |
| InChIKey | VBPSTESAULEKHT-HTYURWOYSA-N |
| XLogP | 5.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|