C17H26O4 — CID 134874981
4b-methylspiro[1,2,3,4,4a,5,6,8,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane]-1,4-diol (PubChem CID 134874981) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 4b-methylspiro[1,2,3,4,4a,5,6,8,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane]-1,4-diol.
| Compound Name | 4b-methylspiro[1,2,3,4,4a,5,6,8,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane]-1,4-diol |
|---|---|
| PubChem CID | 134874981 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 4b-methylspiro[1,2,3,4,4a,5,6,8,10,10a-decahydrophenanthrene-7,2'-1,3-dioxolane]-1,4-diol |
| SMILES | CC12CCC3(CC1=CCC1C(O)CCC(O)C12)OCCO3 |
| InChI | InChI=1S/C17H26O4/c1-16-6-7-17(20-8-9-21-17)10-11(16)2-3-12-13(18)4-5-14(19)15(12)16/h2,12-15,18-19H,3-10H2,1H3 |
| InChIKey | JEHRXQAILDTSTE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|