C32H52O3 — CID 127031582
[(4'aS,6'aR,6'aR,6'bR,8'aR,12'aR,14'aS)-2',2',6'a,6'b,9',9',12'a-heptamethylspiro[1,3-dioxolane-2,10'-4,5,6,6a,7,8,8a,11,12,13,14,14a-dodecahydro-3H-picene]-4'a-yl]methanol (PubChem CID 127031582) has the molecular formula C32H52O3 and a molecular weight of 484.77 g/mol. Its IUPAC name is [(4'aS,6'aR,6'aR,6'bR,8'aR,12'aR,14'aS)-2',2',6'a,6'b,9',9',12'a-heptamethylspiro[1,3-dioxolane-2,10'-4,5,6,6a,7,8,8a,11,12,13,14,14a-dodecahydro-3H-picene]-4'a-yl]methanol.
| Compound Name | [(4'aS,6'aR,6'aR,6'bR,8'aR,12'aR,14'aS)-2',2',6'a,6'b,9',9',12'a-heptamethylspiro[1,3-dioxolane-2,10'-4,5,6,6a,7,8,8a,11,12,13,14,14a-dodecahydro-3H-picene]-4'a-yl]methanol |
|---|---|
| PubChem CID | 127031582 |
| Molecular Formula | C32H52O3 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.39 |
| IUPAC Name | [(4'aS,6'aR,6'aR,6'bR,8'aR,12'aR,14'aS)-2',2',6'a,6'b,9',9',12'a-heptamethylspiro[1,3-dioxolane-2,10'-4,5,6,6a,7,8,8a,11,12,13,14,14a-dodecahydro-3H-picene]-4'a-yl]methanol |
| SMILES | CC1(C)C=C2[C@H]3CC[C@@H]4[C@@]5(C)CCC6(OCCO6)C(C)(C)[C@@H]5CC[C@@]4(C)[C@]3(C)CC[C@@]2(CO)CC1 |
| InChI | InChI=1S/C32H52O3/c1-26(2)12-15-31(21-33)16-14-29(6)22(23(31)20-26)8-9-25-28(5)13-17-32(34-18-19-35-32)27(3,4)24(28)10-11-30(25,29)7/h20,22,24-25,33H,8-19,21H2,1-7H3/t22-,24+,25-,28+,29-,30-,31-/m1/s1 |
| InChIKey | SXYLITRDEAEYTJ-GJZVSPAWSA-N |
| XLogP | 7.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|