C14H22O3 — CID 13260714
[(4aR,8aS)-7-methylspiro[1,2,3,5,8,8a-hexahydronaphthalene-4,2'-1,3-dioxolane]-4a-yl]methanol (PubChem CID 13260714) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is [(4aR,8aS)-7-methylspiro[1,2,3,5,8,8a-hexahydronaphthalene-4,2'-1,3-dioxolane]-4a-yl]methanol.
| Compound Name | [(4aR,8aS)-7-methylspiro[1,2,3,5,8,8a-hexahydronaphthalene-4,2'-1,3-dioxolane]-4a-yl]methanol |
|---|---|
| PubChem CID | 13260714 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | [(4aR,8aS)-7-methylspiro[1,2,3,5,8,8a-hexahydronaphthalene-4,2'-1,3-dioxolane]-4a-yl]methanol |
| SMILES | CC1=CC[C@]2(CO)[C@@H](CCCC23OCCO3)C1 |
| InChI | InChI=1S/C14H22O3/c1-11-4-6-13(10-15)12(9-11)3-2-5-14(13)16-7-8-17-14/h4,12,15H,2-3,5-10H2,1H3/t12-,13-/m0/s1 |
| InChIKey | CXCKPVXOCCJWSD-STQMWFEESA-N |
| XLogP | 2.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|