C21H27FO3 — CID 18635393
(3'aS)-11'b-fluoro-3'a,6'-dimethylspiro[1,3-dioxolane-2,8'-2,4,7,9,10,10a,11,11a-octahydro-1H-cyclopenta[a]anthracene]-3'-one (PubChem CID 18635393) has the molecular formula C21H27FO3 and a molecular weight of 346.44 g/mol. Its IUPAC name is (3'aS)-11'b-fluoro-3'a,6'-dimethylspiro[1,3-dioxolane-2,8'-2,4,7,9,10,10a,11,11a-octahydro-1H-cyclopenta[a]anthracene]-3'-one.
| Compound Name | (3'aS)-11'b-fluoro-3'a,6'-dimethylspiro[1,3-dioxolane-2,8'-2,4,7,9,10,10a,11,11a-octahydro-1H-cyclopenta[a]anthracene]-3'-one |
|---|---|
| PubChem CID | 18635393 |
| Molecular Formula | C21H27FO3 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | (3'aS)-11'b-fluoro-3'a,6'-dimethylspiro[1,3-dioxolane-2,8'-2,4,7,9,10,10a,11,11a-octahydro-1H-cyclopenta[a]anthracene]-3'-one |
| SMILES | CC1=C2CC3(CCC2CC2C1=CC[C@@]1(C)C(=O)CCC21F)OCCO3 |
| InChI | InChI=1S/C21H27FO3/c1-13-15-4-6-19(2)18(23)5-8-21(19,22)17(15)11-14-3-7-20(12-16(13)14)24-9-10-25-20/h4,14,17H,3,5-12H2,1-2H3/t14?,17?,19-,21?/m0/s1 |
| InChIKey | PWHBUPDOMCFMJE-TYKHQRNQSA-N |
| XLogP | 4.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |