C17H24O3 — CID 54294064
(3aR)-3a,6-dimethylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-3-one (PubChem CID 54294064) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3aR)-3a,6-dimethylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-3-one.
| Compound Name | (3aR)-3a,6-dimethylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-3-one |
|---|---|
| PubChem CID | 54294064 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (3aR)-3a,6-dimethylspiro[1,2,4,6,8,9,9a,9b-octahydrocyclopenta[a]naphthalene-7,2'-1,3-dioxolane]-3-one |
| SMILES | CC1C2=CC[C@@]3(C)C(=O)CCC3C2CCC12OCCO2 |
| InChI | InChI=1S/C17H24O3/c1-11-12-5-7-16(2)14(3-4-15(16)18)13(12)6-8-17(11)19-9-10-20-17/h5,11,13-14H,3-4,6-10H2,1-2H3/t11?,13?,14?,16-/m1/s1 |
| InChIKey | RZNUARVBSPCESK-IDJFZPIFSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|