C18H20O10 — CID 10905338
[(2R,3S,4R,6aS,9aS,9bS)-3,4-diacetyloxy-7,9-dioxo-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromen-2-yl]methyl acetate (PubChem CID 10905338) has the molecular formula C18H20O10 and a molecular weight of 396.35 g/mol. Its IUPAC name is [(2R,3S,4R,6aS,9aS,9bS)-3,4-diacetyloxy-7,9-dioxo-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromen-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,6aS,9aS,9bS)-3,4-diacetyloxy-7,9-dioxo-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromen-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10905338 |
| Molecular Formula | C18H20O10 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | [(2R,3S,4R,6aS,9aS,9bS)-3,4-diacetyloxy-7,9-dioxo-3,4,6,6a,9a,9b-hexahydro-2H-furo[3,4-h]chromen-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2C(=CC[C@@H]3C(=O)OC(=O)[C@@H]32)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C18H20O10/c1-7(19)24-6-12-16(26-9(3)21)15(25-8(2)20)11-5-4-10-13(14(11)27-12)18(23)28-17(10)22/h5,10,12-16H,4,6H2,1-3H3/t10-,12+,13-,14+,15+,16+/m0/s1 |
| InChIKey | CGTYVCMTZXRRDH-MRHCDFOMSA-N |
| XLogP | -0.17 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|