C30H40O11 — CID 11685628
[(1S,2S,3S,7S,8R,9R,10S,12Z,14S,17R)-2,7,9-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-10-yl] butanoate (PubChem CID 11685628) has the molecular formula C30H40O11 and a molecular weight of 576.64 g/mol. Its IUPAC name is [(1S,2S,3S,7S,8R,9R,10S,12Z,14S,17R)-2,7,9-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-10-yl] butanoate.
| Compound Name | [(1S,2S,3S,7S,8R,9R,10S,12Z,14S,17R)-2,7,9-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-10-yl] butanoate |
|---|---|
| PubChem CID | 11685628 |
| Molecular Formula | C30H40O11 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.26 |
| IUPAC Name | [(1S,2S,3S,7S,8R,9R,10S,12Z,14S,17R)-2,7,9-triacetyloxy-4,8,12,17-tetramethyl-16-oxo-15,18-dioxatetracyclo[12.4.0.01,17.03,8]octadeca-4,12-dien-10-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1C/C(C)=C\[C@@H]2OC(=O)[C@]3(C)O[C@]23[C@@H](OC(C)=O)[C@H]2C(C)=CC[C@H](OC(C)=O)[C@]2(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H40O11/c1-9-10-23(34)39-20-13-15(2)14-22-30(29(8,41-30)27(35)40-22)26(38-19(6)33)24-16(3)11-12-21(36-17(4)31)28(24,7)25(20)37-18(5)32/h11,14,20-22,24-26H,9-10,12-13H2,1-8H3/b15-14-/t20-,21-,22-,24+,25-,26-,28-,29-,30-/m0/s1 |
| InChIKey | NPTOHZVEIRUREE-CJXYZPBRSA-N |
| XLogP | 3.27 |
| TPSA | 144.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|