C22H32O7 — CID 91067936
[(1R,4R,9R,10R,12R,13R)-1,13-dimethoxy-2,12-dimethyl-8-methylidene-5-oxo-6,15-dioxatricyclo[10.2.1.04,9]pentadec-2-en-10-yl] 2-methylpropanoate (PubChem CID 91067936) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(1R,4R,9R,10R,12R,13R)-1,13-dimethoxy-2,12-dimethyl-8-methylidene-5-oxo-6,15-dioxatricyclo[10.2.1.04,9]pentadec-2-en-10-yl] 2-methylpropanoate.
| Compound Name | [(1R,4R,9R,10R,12R,13R)-1,13-dimethoxy-2,12-dimethyl-8-methylidene-5-oxo-6,15-dioxatricyclo[10.2.1.04,9]pentadec-2-en-10-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 91067936 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [(1R,4R,9R,10R,12R,13R)-1,13-dimethoxy-2,12-dimethyl-8-methylidene-5-oxo-6,15-dioxatricyclo[10.2.1.04,9]pentadec-2-en-10-yl] 2-methylpropanoate |
| SMILES | C=C1COC(=O)[C@@H]2C=C(C)[C@@]3(OC)C[C@@H](OC)[C@@](C)(C[C@@H](OC(=O)C(C)C)[C@@H]12)O3 |
| InChI | InChI=1S/C22H32O7/c1-12(2)19(23)28-16-9-21(5)17(25-6)10-22(26-7,29-21)14(4)8-15-18(16)13(3)11-27-20(15)24/h8,12,15-18H,3,9-11H2,1-2,4-7H3/t15-,16-,17-,18+,21-,22-/m1/s1 |
| InChIKey | NCJQBILXAICDLY-HLDKGHONSA-N |
| XLogP | 2.79 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|