C16H22O6 — CID 5255032
methyl 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methyl-3-oxo-1,4,5,7a-tetrahydro-2-benzofuran-3a-carboxylate (PubChem CID 5255032) has the molecular formula C16H22O6 and a molecular weight of 310.35 g/mol. Its IUPAC name is methyl 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methyl-3-oxo-1,4,5,7a-tetrahydro-2-benzofuran-3a-carboxylate.
| Compound Name | methyl 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methyl-3-oxo-1,4,5,7a-tetrahydro-2-benzofuran-3a-carboxylate |
|---|---|
| PubChem CID | 5255032 |
| Molecular Formula | C16H22O6 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | methyl 6-(2,2-dimethyl-1,3-dioxolan-4-yl)-7-methyl-3-oxo-1,4,5,7a-tetrahydro-2-benzofuran-3a-carboxylate |
| SMILES | COC(=O)C12CCC(C3COC(C)(C)O3)=C(C)C1COC2=O |
| InChI | InChI=1S/C16H22O6/c1-9-10(12-8-21-15(2,3)22-12)5-6-16(13(17)19-4)11(9)7-20-14(16)18/h11-12H,5-8H2,1-4H3 |
| InChIKey | AMLVAKBWDHOADI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|