C17H24O5 — CID 134979875
dimethyl (1S,2R,8S,9S,10R)-4,4,7-trimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene-9,10-dicarboxylate (PubChem CID 134979875) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is dimethyl (1S,2R,8S,9S,10R)-4,4,7-trimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene-9,10-dicarboxylate.
| Compound Name | dimethyl (1S,2R,8S,9S,10R)-4,4,7-trimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene-9,10-dicarboxylate |
|---|---|
| PubChem CID | 134979875 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | dimethyl (1S,2R,8S,9S,10R)-4,4,7-trimethyl-11-oxatricyclo[6.2.1.02,6]undec-6-ene-9,10-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2O[C@H](C(C)=C3CC(C)(C)C[C@H]32)[C@H]1C(=O)OC |
| InChI | InChI=1S/C17H24O5/c1-8-9-6-17(2,3)7-10(9)14-12(16(19)21-5)11(13(8)22-14)15(18)20-4/h10-14H,6-7H2,1-5H3/t10-,11+,12-,13-,14+/m1/s1 |
| InChIKey | DFBDQIKNPOFTPL-ITGHMWBKSA-N |
| XLogP | 2.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|