C20H28O5 — CID 139257450
dimethyl (3aR,5Z,5aS)-5-(2,2-dimethylpropylidene)-3,3a,4,5a,6,8-hexahydro-1H-cyclopenta[e][2]benzofuran-7,7-dicarboxylate (PubChem CID 139257450) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is dimethyl (3aR,5Z,5aS)-5-(2,2-dimethylpropylidene)-3,3a,4,5a,6,8-hexahydro-1H-cyclopenta[e][2]benzofuran-7,7-dicarboxylate.
| Compound Name | dimethyl (3aR,5Z,5aS)-5-(2,2-dimethylpropylidene)-3,3a,4,5a,6,8-hexahydro-1H-cyclopenta[e][2]benzofuran-7,7-dicarboxylate |
|---|---|
| PubChem CID | 139257450 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | dimethyl (3aR,5Z,5aS)-5-(2,2-dimethylpropylidene)-3,3a,4,5a,6,8-hexahydro-1H-cyclopenta[e][2]benzofuran-7,7-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C3COC[C@@H]3C/C(=C/C(C)(C)C)[C@@H]2C1 |
| InChI | InChI=1S/C20H28O5/c1-19(2,3)7-12-6-13-10-25-11-16(13)15-9-20(8-14(12)15,17(21)23-4)18(22)24-5/h7,13-14H,6,8-11H2,1-5H3/b12-7-/t13-,14-/m0/s1 |
| InChIKey | MGPVICZVRLJOFT-OBFMZJQYSA-N |
| XLogP | 3.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|