C20H32O8 — CID 10862275
methyl (4R)-4-[(3S,3aR,7aR)-3a-(methoxymethoxymethyl)-3,6-dimethyl-2-oxo-5,7a-dihydro-4H-1-benzofuran-3-yl]-4-(methoxymethoxy)butanoate (PubChem CID 10862275) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is methyl (4R)-4-[(3S,3aR,7aR)-3a-(methoxymethoxymethyl)-3,6-dimethyl-2-oxo-5,7a-dihydro-4H-1-benzofuran-3-yl]-4-(methoxymethoxy)butanoate.
| Compound Name | methyl (4R)-4-[(3S,3aR,7aR)-3a-(methoxymethoxymethyl)-3,6-dimethyl-2-oxo-5,7a-dihydro-4H-1-benzofuran-3-yl]-4-(methoxymethoxy)butanoate |
|---|---|
| PubChem CID | 10862275 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | methyl (4R)-4-[(3S,3aR,7aR)-3a-(methoxymethoxymethyl)-3,6-dimethyl-2-oxo-5,7a-dihydro-4H-1-benzofuran-3-yl]-4-(methoxymethoxy)butanoate |
| SMILES | COCOC[C@]12CCC(C)=C[C@H]1OC(=O)[C@]2(C)[C@@H](CCC(=O)OC)OCOC |
| InChI | InChI=1S/C20H32O8/c1-14-8-9-20(11-26-12-23-3)16(10-14)28-18(22)19(20,2)15(27-13-24-4)6-7-17(21)25-5/h10,15-16H,6-9,11-13H2,1-5H3/t15-,16-,19+,20-/m1/s1 |
| InChIKey | GYEBLVLFNPIXPN-YAJHFMINSA-N |
| XLogP | 2.21 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|