C21H32O4 — CID 170990713
(1R,3S,4S,7E,11S,18R)-3-methoxy-4,8,11,18-tetramethyl-2,14-dioxatricyclo[9.5.2.012,16]octadeca-7,12(16)-dien-15-one (PubChem CID 170990713) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1R,3S,4S,7E,11S,18R)-3-methoxy-4,8,11,18-tetramethyl-2,14-dioxatricyclo[9.5.2.012,16]octadeca-7,12(16)-dien-15-one.
| Compound Name | (1R,3S,4S,7E,11S,18R)-3-methoxy-4,8,11,18-tetramethyl-2,14-dioxatricyclo[9.5.2.012,16]octadeca-7,12(16)-dien-15-one |
|---|---|
| PubChem CID | 170990713 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1R,3S,4S,7E,11S,18R)-3-methoxy-4,8,11,18-tetramethyl-2,14-dioxatricyclo[9.5.2.012,16]octadeca-7,12(16)-dien-15-one |
| SMILES | CO[C@H]1O[C@@H]2C[C@@H](C)[C@](C)(CC/C(C)=C/CC[C@@H]1C)C1=C2C(=O)OC1 |
| InChI | InChI=1S/C21H32O4/c1-13-7-6-8-14(2)20(23-5)25-17-11-15(3)21(4,10-9-13)16-12-24-19(22)18(16)17/h7,14-15,17,20H,6,8-12H2,1-5H3/b13-7+/t14-,15+,17+,20-,21-/m0/s1 |
| InChIKey | XIWGEVQHBRKWDH-FLCLTOLOSA-N |
| XLogP | 4.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|