C19H28O2 — CID 163041881
(6E,10S)-7-methyl-10-(5-methylhex-4-enyl)-3,4,5,8,9,10-hexahydrocyclonona[c]furan-1-one (PubChem CID 163041881) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (6E,10S)-7-methyl-10-(5-methylhex-4-enyl)-3,4,5,8,9,10-hexahydrocyclonona[c]furan-1-one.
| Compound Name | (6E,10S)-7-methyl-10-(5-methylhex-4-enyl)-3,4,5,8,9,10-hexahydrocyclonona[c]furan-1-one |
|---|---|
| PubChem CID | 163041881 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (6E,10S)-7-methyl-10-(5-methylhex-4-enyl)-3,4,5,8,9,10-hexahydrocyclonona[c]furan-1-one |
| SMILES | CC(C)=CCCC[C@H]1CC/C(C)=C/CCC2=C1C(=O)OC2 |
| InChI | InChI=1S/C19H28O2/c1-14(2)7-4-5-9-16-12-11-15(3)8-6-10-17-13-21-19(20)18(16)17/h7-8,16H,4-6,9-13H2,1-3H3/b15-8+/t16-/m0/s1 |
| InChIKey | YSISNZLASMTUCN-AHQMPEJBSA-N |
| XLogP | 5.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|