C14H22 — CID 11636969
1-ethenyl-5-(5-methylhex-4-enyl)cyclopentene (PubChem CID 11636969) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1-ethenyl-5-(5-methylhex-4-enyl)cyclopentene.
| Compound Name | 1-ethenyl-5-(5-methylhex-4-enyl)cyclopentene |
|---|---|
| PubChem CID | 11636969 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1-ethenyl-5-(5-methylhex-4-enyl)cyclopentene |
| SMILES | C=CC1=CCCC1CCCC=C(C)C |
| InChI | InChI=1S/C14H22/c1-4-13-10-7-11-14(13)9-6-5-8-12(2)3/h4,8,10,14H,1,5-7,9,11H2,2-3H3 |
| InChIKey | BIEHLDPVCQNLRD-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|