C19H30 — CID 142233554
(4S)-4-methyl-1-(5-methylhex-4-enyl)-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalene (PubChem CID 142233554) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is (4S)-4-methyl-1-(5-methylhex-4-enyl)-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalene.
| Compound Name | (4S)-4-methyl-1-(5-methylhex-4-enyl)-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 142233554 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | (4S)-4-methyl-1-(5-methylhex-4-enyl)-7-methylidene-2,3,4,4a,5,6-hexahydro-1H-naphthalene |
| SMILES | C=C1C=C2C(CCCC=C(C)C)CC[C@H](C)C2CC1 |
| InChI | InChI=1S/C19H30/c1-14(2)7-5-6-8-17-11-10-16(4)18-12-9-15(3)13-19(17)18/h7,13,16-18H,3,5-6,8-12H2,1-2,4H3/t16-,17?,18?/m0/s1 |
| InChIKey | GKOHOJHJTURYML-AOCRQIFASA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|