C20H30O2 — CID 165025307
(5R,8R)-2,5-dimethyl-8-(5-methylhex-4-enyl)-5,6,7,8-tetrahydronaphthalene-1,4-dione;methane (PubChem CID 165025307) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (5R,8R)-2,5-dimethyl-8-(5-methylhex-4-enyl)-5,6,7,8-tetrahydronaphthalene-1,4-dione;methane.
| Compound Name | (5R,8R)-2,5-dimethyl-8-(5-methylhex-4-enyl)-5,6,7,8-tetrahydronaphthalene-1,4-dione;methane |
|---|---|
| PubChem CID | 165025307 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (5R,8R)-2,5-dimethyl-8-(5-methylhex-4-enyl)-5,6,7,8-tetrahydronaphthalene-1,4-dione;methane |
| SMILES | C.CC(C)=CCCC[C@@H]1CC[C@@H](C)C2=C1C(=O)C(C)=CC2=O |
| InChI | InChI=1S/C19H26O2.CH4/c1-12(2)7-5-6-8-15-10-9-13(3)17-16(20)11-14(4)19(21)18(15)17;/h7,11,13,15H,5-6,8-10H2,1-4H3;1H4/t13-,15-;/m1./s1 |
| InChIKey | LUEYHVBYOQIQKJ-SWYZXDRTSA-N |
| XLogP | 5.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|