C19H24O2 — CID 102182503
(4R,6S,6aR,9S)-6,9-dimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalene-1,2-dione (PubChem CID 102182503) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (4R,6S,6aR,9S)-6,9-dimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalene-1,2-dione.
| Compound Name | (4R,6S,6aR,9S)-6,9-dimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalene-1,2-dione |
|---|---|
| PubChem CID | 102182503 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (4R,6S,6aR,9S)-6,9-dimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalene-1,2-dione |
| SMILES | CC(C)=C[C@H]1C[C@H](C)[C@H]2CC[C@H](C)C3=C2C1=CC(=O)C3=O |
| InChI | InChI=1S/C19H24O2/c1-10(2)7-13-8-12(4)14-6-5-11(3)17-18(14)15(13)9-16(20)19(17)21/h7,9,11-14H,5-6,8H2,1-4H3/t11-,12-,13-,14+/m0/s1 |
| InChIKey | WBWKNDPBLKNZPO-XDQVBPFNSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|