C10H14O — CID 124820528
(1R,3S,5S)-3-(2-methylprop-1-enyl)bicyclo[3.1.0]hexan-2-one (PubChem CID 124820528) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (1R,3S,5S)-3-(2-methylprop-1-enyl)bicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,3S,5S)-3-(2-methylprop-1-enyl)bicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 124820528 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (1R,3S,5S)-3-(2-methylprop-1-enyl)bicyclo[3.1.0]hexan-2-one |
| SMILES | CC(C)=C[C@@H]1C[C@@H]2C[C@H]2C1=O |
| InChI | InChI=1S/C10H14O/c1-6(2)3-8-4-7-5-9(7)10(8)11/h3,7-9H,4-5H2,1-2H3/t7-,8-,9-/m1/s1 |
| InChIKey | BQQHXKCKJZJHLC-IWSPIJDZSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|