C20H28O2 — CID 85470647
(4R,6R,6aS,9R)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-4,5,6,6a,7,8,9,9a-octahydro-3H-phenalene-1,2-dione (PubChem CID 85470647) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (4R,6R,6aS,9R)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-4,5,6,6a,7,8,9,9a-octahydro-3H-phenalene-1,2-dione.
| Compound Name | (4R,6R,6aS,9R)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-4,5,6,6a,7,8,9,9a-octahydro-3H-phenalene-1,2-dione |
|---|---|
| PubChem CID | 85470647 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (4R,6R,6aS,9R)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-4,5,6,6a,7,8,9,9a-octahydro-3H-phenalene-1,2-dione |
| SMILES | CC(C)=C[C@H]1C[C@@H](C)[C@@H]2CC[C@@H](C)C3C(=O)C(=O)C(C)C1=C32 |
| InChI | InChI=1S/C20H28O2/c1-10(2)8-14-9-12(4)15-7-6-11(3)16-18(15)17(14)13(5)19(21)20(16)22/h8,11-16H,6-7,9H2,1-5H3/t11-,12-,13?,14+,15+,16?/m1/s1 |
| InChIKey | KBTILJAVZDMFMY-IEGVYBCMSA-N |
| XLogP | 4.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|