C28H36O4S — CID 10983529
[(4R,6S,6aR,9S)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-1-phenylmethoxy-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl] methanesulfonate (PubChem CID 10983529) has the molecular formula C28H36O4S and a molecular weight of 468.66 g/mol. Its IUPAC name is [(4R,6S,6aR,9S)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-1-phenylmethoxy-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl] methanesulfonate.
| Compound Name | [(4R,6S,6aR,9S)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-1-phenylmethoxy-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 10983529 |
| Molecular Formula | C28H36O4S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | [(4R,6S,6aR,9S)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-1-phenylmethoxy-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-yl] methanesulfonate |
| SMILES | CC(C)=C[C@H]1C[C@H](C)[C@H]2CC[C@H](C)c3c(OCc4ccccc4)c(OS(C)(=O)=O)c(C)c1c32 |
| InChI | InChI=1S/C28H36O4S/c1-17(2)14-22-15-19(4)23-13-12-18(3)24-26(23)25(22)20(5)27(32-33(6,29)30)28(24)31-16-21-10-8-7-9-11-21/h7-11,14,18-19,22-23H,12-13,15-16H2,1-6H3/t18-,19-,22-,23+/m0/s1 |
| InChIKey | VZDFDRZEUZGSHO-DHNNRRLOSA-N |
| XLogP | 6.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|