C18H19NO2 — CID 170876730
(Z)-3-(3,5-dimethyl-4-phenylmethoxyphenyl)prop-2-enamide (PubChem CID 170876730) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (Z)-3-(3,5-dimethyl-4-phenylmethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(3,5-dimethyl-4-phenylmethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 170876730 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (Z)-3-(3,5-dimethyl-4-phenylmethoxyphenyl)prop-2-enamide |
| SMILES | Cc1cc(/C=C\C(N)=O)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-13-10-16(8-9-17(19)20)11-14(2)18(13)21-12-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3,(H2,19,20)/b9-8- |
| InChIKey | MSPPXDKQNHXVNQ-HJWRWDBZSA-N |
| XLogP | 3.38 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|