C28H36O4S — CID 11145097
[(5R,8S)-3,8-dimethyl-5-[(2S,3E)-6-methylhepta-3,5-dien-2-yl]-1-phenylmethoxy-5,6,7,8-tetrahydronaphthalen-2-yl] methanesulfonate (PubChem CID 11145097) has the molecular formula C28H36O4S and a molecular weight of 468.66 g/mol. Its IUPAC name is [(5R,8S)-3,8-dimethyl-5-[(2S,3E)-6-methylhepta-3,5-dien-2-yl]-1-phenylmethoxy-5,6,7,8-tetrahydronaphthalen-2-yl] methanesulfonate.
| Compound Name | [(5R,8S)-3,8-dimethyl-5-[(2S,3E)-6-methylhepta-3,5-dien-2-yl]-1-phenylmethoxy-5,6,7,8-tetrahydronaphthalen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 11145097 |
| Molecular Formula | C28H36O4S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | [(5R,8S)-3,8-dimethyl-5-[(2S,3E)-6-methylhepta-3,5-dien-2-yl]-1-phenylmethoxy-5,6,7,8-tetrahydronaphthalen-2-yl] methanesulfonate |
| SMILES | CC(C)=C/C=C/[C@H](C)[C@H]1CC[C@H](C)c2c1cc(C)c(OS(C)(=O)=O)c2OCc1ccccc1 |
| InChI | InChI=1S/C28H36O4S/c1-19(2)11-10-12-20(3)24-16-15-21(4)26-25(24)17-22(5)27(32-33(6,29)30)28(26)31-18-23-13-8-7-9-14-23/h7-14,17,20-21,24H,15-16,18H2,1-6H3/b12-10+/t20-,21-,24+/m0/s1 |
| InChIKey | TYFILFUWMDJPCL-UYPNGPOCSA-N |
| XLogP | 7.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|