C28H36O2 — CID 91586402
(4S)-6-methoxy-4,7-dimethyl-1-(6-methylhepta-3,5-dien-2-yl)-5-phenylmethoxy-1,2,3,4-tetrahydronaphthalene (PubChem CID 91586402) has the molecular formula C28H36O2 and a molecular weight of 404.59 g/mol. Its IUPAC name is (4S)-6-methoxy-4,7-dimethyl-1-(6-methylhepta-3,5-dien-2-yl)-5-phenylmethoxy-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (4S)-6-methoxy-4,7-dimethyl-1-(6-methylhepta-3,5-dien-2-yl)-5-phenylmethoxy-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 91586402 |
| Molecular Formula | C28H36O2 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | (4S)-6-methoxy-4,7-dimethyl-1-(6-methylhepta-3,5-dien-2-yl)-5-phenylmethoxy-1,2,3,4-tetrahydronaphthalene |
| SMILES | COc1c(C)cc2c(c1OCc1ccccc1)[C@@H](C)CCC2C(C)C=CC=C(C)C |
| InChI | InChI=1S/C28H36O2/c1-19(2)11-10-12-20(3)24-16-15-21(4)26-25(24)17-22(5)27(29-6)28(26)30-18-23-13-8-7-9-14-23/h7-14,17,20-21,24H,15-16,18H2,1-6H3/t20?,21-,24?/m0/s1 |
| InChIKey | NHLSRCPMDFESPZ-DQBMGFJSSA-N |
| XLogP | 7.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|