C28H40O7 — CID 23426263
[2-[[(4S,6R,6aS,9R)-2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-1-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] acetate (PubChem CID 23426263) has the molecular formula C28H40O7 and a molecular weight of 488.62 g/mol. Its IUPAC name is [2-[[(4S,6R,6aS,9R)-2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-1-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] acetate.
| Compound Name | [2-[[(4S,6R,6aS,9R)-2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-1-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] acetate |
|---|---|
| PubChem CID | 23426263 |
| Molecular Formula | C28H40O7 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | [2-[[(4S,6R,6aS,9R)-2-hydroxy-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-5,6,6a,7,8,9-hexahydro-4H-phenalen-1-yl]oxy]-3,5-dihydroxy-6-methyloxan-4-yl] acetate |
| SMILES | CC(=O)OC1C(O)C(C)OC(Oc2c(O)c(C)c3c4c2[C@H](C)CC[C@H]4[C@H](C)C[C@H]3C=C(C)C)C1O |
| InChI | InChI=1S/C28H40O7/c1-12(2)10-18-11-14(4)19-9-8-13(3)20-22(19)21(18)15(5)23(30)26(20)35-28-25(32)27(34-17(7)29)24(31)16(6)33-28/h10,13-14,16,18-19,24-25,27-28,30-32H,8-9,11H2,1-7H3/t13-,14-,16?,18-,19+,24?,25?,27?,28?/m1/s1 |
| InChIKey | MPMPOGJFRKACCV-SPMNQTINSA-N |
| XLogP | 4.55 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|