C18H25IO8 — CID 142405669
1-[4-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-5-iodo-2,3-dimethoxy-6-methylphenyl]ethanone (PubChem CID 142405669) has the molecular formula C18H25IO8 and a molecular weight of 496.29 g/mol. Its IUPAC name is 1-[4-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-5-iodo-2,3-dimethoxy-6-methylphenyl]ethanone.
| Compound Name | 1-[4-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-5-iodo-2,3-dimethoxy-6-methylphenyl]ethanone |
|---|---|
| PubChem CID | 142405669 |
| Molecular Formula | C18H25IO8 |
| Molecular Weight | 496.29 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | 1-[4-[(2S,3R,4R,5S,6S)-3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl]oxy-5-iodo-2,3-dimethoxy-6-methylphenyl]ethanone |
| SMILES | COc1c(O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](OC)[C@H]2O)c(I)c(C)c(C(C)=O)c1OC |
| InChI | InChI=1S/C18H25IO8/c1-7-10(8(2)20)14(23-4)17(25-6)15(11(7)19)27-18-13(22)16(24-5)12(21)9(3)26-18/h9,12-13,16,18,21-22H,1-6H3/t9-,12-,13+,16+,18-/m0/s1 |
| InChIKey | QJAMZVGMKOAISR-BVODFQLXSA-N |
| XLogP | 1.68 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|