C22H29IO11 — CID 134937438
methyl 4-[(3R,4R,5S,6S)-3,5-diacetyloxy-4-methoxy-6-methyloxan-2-yl]oxy-5-iodo-2,3-dimethoxy-6-methylbenzoate (PubChem CID 134937438) has the molecular formula C22H29IO11 and a molecular weight of 596.37 g/mol. Its IUPAC name is methyl 4-[(3R,4R,5S,6S)-3,5-diacetyloxy-4-methoxy-6-methyloxan-2-yl]oxy-5-iodo-2,3-dimethoxy-6-methylbenzoate.
| Compound Name | methyl 4-[(3R,4R,5S,6S)-3,5-diacetyloxy-4-methoxy-6-methyloxan-2-yl]oxy-5-iodo-2,3-dimethoxy-6-methylbenzoate |
|---|---|
| PubChem CID | 134937438 |
| Molecular Formula | C22H29IO11 |
| Molecular Weight | 596.37 g/mol |
| Exact Mass | 596.08 |
| IUPAC Name | methyl 4-[(3R,4R,5S,6S)-3,5-diacetyloxy-4-methoxy-6-methyloxan-2-yl]oxy-5-iodo-2,3-dimethoxy-6-methylbenzoate |
| SMILES | COC(=O)c1c(C)c(I)c(OC2O[C@@H](C)[C@H](OC(C)=O)[C@@H](OC)[C@H]2OC(C)=O)c(OC)c1OC |
| InChI | InChI=1S/C22H29IO11/c1-9-13(21(26)30-8)16(27-5)19(29-7)17(14(9)23)34-22-20(33-12(4)25)18(28-6)15(10(2)31-22)32-11(3)24/h10,15,18,20,22H,1-8H3/t10-,15-,18+,20+,22?/m0/s1 |
| InChIKey | QQUIJWIGTZKHCY-NQLZLPHXSA-N |
| XLogP | 2.41 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|