C29H44O6 — CID 54232150
(4R,9R)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-1-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxy-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-ol (PubChem CID 54232150) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is (4R,9R)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-1-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxy-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-ol.
| Compound Name | (4R,9R)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-1-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxy-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-ol |
|---|---|
| PubChem CID | 54232150 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | (4R,9R)-3,6,9-trimethyl-4-(2-methylprop-1-enyl)-1-(3,4,5-trimethoxy-6-methyloxan-2-yl)oxy-5,6,6a,7,8,9-hexahydro-4H-phenalen-2-ol |
| SMILES | COC1C(C)OC(Oc2c(O)c(C)c3c4c2[C@H](C)CCC4C(C)C[C@@H]3C=C(C)C)C(OC)C1OC |
| InChI | InChI=1S/C29H44O6/c1-14(2)12-19-13-16(4)20-11-10-15(3)21-23(20)22(19)17(5)24(30)26(21)35-29-28(33-9)27(32-8)25(31-7)18(6)34-29/h12,15-16,18-20,25,27-30H,10-11,13H2,1-9H3/t15-,16?,18?,19+,20?,25?,27?,28?,29?/m1/s1 |
| InChIKey | ZUVYWRYGBOACEO-KOPVLRGTSA-N |
| XLogP | 5.94 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|