C19H28O3 — CID 22832512
(5E,8R,11S)-6-methyl-11-(6-methylhept-5-en-2-yl)-9-oxabicyclo[6.2.1]undec-5-ene-2,10-dione (PubChem CID 22832512) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (5E,8R,11S)-6-methyl-11-(6-methylhept-5-en-2-yl)-9-oxabicyclo[6.2.1]undec-5-ene-2,10-dione.
| Compound Name | (5E,8R,11S)-6-methyl-11-(6-methylhept-5-en-2-yl)-9-oxabicyclo[6.2.1]undec-5-ene-2,10-dione |
|---|---|
| PubChem CID | 22832512 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (5E,8R,11S)-6-methyl-11-(6-methylhept-5-en-2-yl)-9-oxabicyclo[6.2.1]undec-5-ene-2,10-dione |
| SMILES | CC(C)=CCCC(C)[C@H]1C2C(=O)CC/C=C(/C)C[C@H]1OC2=O |
| InChI | InChI=1S/C19H28O3/c1-12(2)7-5-9-14(4)17-16-11-13(3)8-6-10-15(20)18(17)19(21)22-16/h7-8,14,16-18H,5-6,9-11H2,1-4H3/b13-8-/t14?,16-,17-,18?/m1/s1 |
| InChIKey | FPYZUFKATBLLIY-LRHJYQFSSA-N |
| XLogP | 4.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|