C22H32O4 — CID 163013310
[(6E,9R,10S,10aS)-7-methyl-10-(6-methylhept-5-en-2-yl)-3-oxo-1,5,8,9,10,10a-hexahydrocyclonona[c]furan-9-yl] acetate (PubChem CID 163013310) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(6E,9R,10S,10aS)-7-methyl-10-(6-methylhept-5-en-2-yl)-3-oxo-1,5,8,9,10,10a-hexahydrocyclonona[c]furan-9-yl] acetate.
| Compound Name | [(6E,9R,10S,10aS)-7-methyl-10-(6-methylhept-5-en-2-yl)-3-oxo-1,5,8,9,10,10a-hexahydrocyclonona[c]furan-9-yl] acetate |
|---|---|
| PubChem CID | 163013310 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(6E,9R,10S,10aS)-7-methyl-10-(6-methylhept-5-en-2-yl)-3-oxo-1,5,8,9,10,10a-hexahydrocyclonona[c]furan-9-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C/C(C)=C/CC=C2C(=O)OC[C@H]2[C@@H]1C(C)CCC=C(C)C |
| InChI | InChI=1S/C22H32O4/c1-14(2)8-6-10-16(4)21-19-13-25-22(24)18(19)11-7-9-15(3)12-20(21)26-17(5)23/h8-9,11,16,19-21H,6-7,10,12-13H2,1-5H3/b15-9+,18-11?/t16?,19-,20-,21+/m1/s1 |
| InChIKey | MFANFVLPLDXKAO-QPVLRBICSA-N |
| XLogP | 4.76 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|