C20H30O4 — CID 162873867
(4R,6R,8R,9S,10S)-8-hydroxy-6-methyl-9-[(2R)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-en-13-one (PubChem CID 162873867) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (4R,6R,8R,9S,10S)-8-hydroxy-6-methyl-9-[(2R)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-en-13-one.
| Compound Name | (4R,6R,8R,9S,10S)-8-hydroxy-6-methyl-9-[(2R)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-en-13-one |
|---|---|
| PubChem CID | 162873867 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (4R,6R,8R,9S,10S)-8-hydroxy-6-methyl-9-[(2R)-6-methylhept-5-en-2-yl]-5,12-dioxatricyclo[8.3.0.04,6]tridec-1-en-13-one |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1[C@H](O)C[C@@]2(C)O[C@@H]2CC=C2C(=O)OC[C@H]21 |
| InChI | InChI=1S/C20H30O4/c1-12(2)6-5-7-13(3)18-15-11-23-19(22)14(15)8-9-17-20(4,24-17)10-16(18)21/h6,8,13,15-18,21H,5,7,9-11H2,1-4H3/t13-,15-,16-,17-,18+,20-/m1/s1 |
| InChIKey | VWLSFZIMFNLSBI-UKQDEDAGSA-N |
| XLogP | 3.40 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|