C20H30O2 — CID 162885429
(1R,2S,5S,6S,7R,9R)-9-methyl-6-[(2R)-6-methylhept-5-en-2-yl]-3-oxatetracyclo[7.3.0.01,5.02,12]dodec-10-en-7-ol (PubChem CID 162885429) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,2S,5S,6S,7R,9R)-9-methyl-6-[(2R)-6-methylhept-5-en-2-yl]-3-oxatetracyclo[7.3.0.01,5.02,12]dodec-10-en-7-ol.
| Compound Name | (1R,2S,5S,6S,7R,9R)-9-methyl-6-[(2R)-6-methylhept-5-en-2-yl]-3-oxatetracyclo[7.3.0.01,5.02,12]dodec-10-en-7-ol |
|---|---|
| PubChem CID | 162885429 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,2S,5S,6S,7R,9R)-9-methyl-6-[(2R)-6-methylhept-5-en-2-yl]-3-oxatetracyclo[7.3.0.01,5.02,12]dodec-10-en-7-ol |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1[C@H](O)C[C@]2(C)C=CC3[C@@H]4OC[C@@H]1[C@]342 |
| InChI | InChI=1S/C20H30O2/c1-12(2)6-5-7-13(3)17-15-11-22-18-14-8-9-19(4,10-16(17)21)20(14,15)18/h6,8-9,13-18,21H,5,7,10-11H2,1-4H3/t13-,14?,15+,16-,17+,18+,19+,20-/m1/s1 |
| InChIKey | CUCAPGMQQFZEDR-HYOMVSPLSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|