C19H28O5 — CID 102509017
(3aR,9R,9aR)-9-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-8,8-dimethyl-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-2-one (PubChem CID 102509017) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (3aR,9R,9aR)-9-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-8,8-dimethyl-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-2-one.
| Compound Name | (3aR,9R,9aR)-9-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-8,8-dimethyl-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-2-one |
|---|---|
| PubChem CID | 102509017 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (3aR,9R,9aR)-9-[(5,5-dimethyl-1,3-dioxan-2-yl)methyl]-8,8-dimethyl-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-2-one |
| SMILES | CC1(C)COC(C[C@@H]2C(C)(C)CC=C3CO[C@@H]4CC(=O)O[C@@]324)OC1 |
| InChI | InChI=1S/C19H28O5/c1-17(2)10-22-16(23-11-17)7-13-18(3,4)6-5-12-9-21-14-8-15(20)24-19(12,13)14/h5,13-14,16H,6-11H2,1-4H3/t13-,14-,19+/m1/s1 |
| InChIKey | SORDAFJNLCNWKG-LPMFXHHGSA-N |
| XLogP | 2.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|