C15H22O5 — CID 11219785
(3aR,7aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7a-(hydroxymethyl)-4-methyl-3,3a,6,7-tetrahydro-2-benzofuran-1-one (PubChem CID 11219785) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3aR,7aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7a-(hydroxymethyl)-4-methyl-3,3a,6,7-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3aR,7aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7a-(hydroxymethyl)-4-methyl-3,3a,6,7-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 11219785 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (3aR,7aS)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-7a-(hydroxymethyl)-4-methyl-3,3a,6,7-tetrahydro-2-benzofuran-1-one |
| SMILES | CC1=C([C@@H]2COC(C)(C)O2)CC[C@]2(CO)C(=O)OC[C@H]12 |
| InChI | InChI=1S/C15H22O5/c1-9-10(12-7-19-14(2,3)20-12)4-5-15(8-16)11(9)6-18-13(15)17/h11-12,16H,4-8H2,1-3H3/t11-,12+,15-/m1/s1 |
| InChIKey | MHBNOFGTWJIGQT-TYNCELHUSA-N |
| XLogP | 1.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|