C17H28N4O — CID 109250532
2-(cyclohexylamino)-N,N-dipropylpyrimidine-5-carboxamide (PubChem CID 109250532) has the molecular formula C17H28N4O and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-(cyclohexylamino)-N,N-dipropylpyrimidine-5-carboxamide.
| Compound Name | 2-(cyclohexylamino)-N,N-dipropylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109250532 |
| Molecular Formula | C17H28N4O |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.23 |
| IUPAC Name | 2-(cyclohexylamino)-N,N-dipropylpyrimidine-5-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cnc(NC2CCCCC2)nc1 |
| InChI | InChI=1S/C17H28N4O/c1-3-10-21(11-4-2)16(22)14-12-18-17(19-13-14)20-15-8-6-5-7-9-15/h12-13,15H,3-11H2,1-2H3,(H,18,19,20) |
| InChIKey | ZQCABNSDTRTUEA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |