C19H32N4O — CID 109332852
2-(cycloheptylamino)-6-methyl-N,N-dipropylpyrimidine-4-carboxamide (PubChem CID 109332852) has the molecular formula C19H32N4O and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-(cycloheptylamino)-6-methyl-N,N-dipropylpyrimidine-4-carboxamide.
| Compound Name | 2-(cycloheptylamino)-6-methyl-N,N-dipropylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109332852 |
| Molecular Formula | C19H32N4O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | 2-(cycloheptylamino)-6-methyl-N,N-dipropylpyrimidine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)nc(NC2CCCCCC2)n1 |
| InChI | InChI=1S/C19H32N4O/c1-4-12-23(13-5-2)18(24)17-14-15(3)20-19(22-17)21-16-10-8-6-7-9-11-16/h14,16H,4-13H2,1-3H3,(H,20,21,22) |
| InChIKey | CUAQKHWECCJHPE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |