C17H17N5O4 — CID 109254428
4-[2-(1,3-benzodioxol-5-ylamino)pyrimidine-5-carbonyl]piperazine-1-carbaldehyde (PubChem CID 109254428) has the molecular formula C17H17N5O4 and a molecular weight of 355.35 g/mol. Its IUPAC name is 4-[2-(1,3-benzodioxol-5-ylamino)pyrimidine-5-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[2-(1,3-benzodioxol-5-ylamino)pyrimidine-5-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 109254428 |
| Molecular Formula | C17H17N5O4 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 4-[2-(1,3-benzodioxol-5-ylamino)pyrimidine-5-carbonyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C(=O)c2cnc(Nc3ccc4c(c3)OCO4)nc2)CC1 |
| InChI | InChI=1S/C17H17N5O4/c23-10-21-3-5-22(6-4-21)16(24)12-8-18-17(19-9-12)20-13-1-2-14-15(7-13)26-11-25-14/h1-2,7-10H,3-6,11H2,(H,18,19,20) |
| InChIKey | LMQBSQLXTGOKTL-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|