C22H24N4O — CID 109258364
N-benzyl-2-(2,3-dimethylanilino)-N-ethylpyrimidine-5-carboxamide (PubChem CID 109258364) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is N-benzyl-2-(2,3-dimethylanilino)-N-ethylpyrimidine-5-carboxamide.
| Compound Name | N-benzyl-2-(2,3-dimethylanilino)-N-ethylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109258364 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-benzyl-2-(2,3-dimethylanilino)-N-ethylpyrimidine-5-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1cnc(Nc2cccc(C)c2C)nc1 |
| InChI | InChI=1S/C22H24N4O/c1-4-26(15-18-10-6-5-7-11-18)21(27)19-13-23-22(24-14-19)25-20-12-8-9-16(2)17(20)3/h5-14H,4,15H2,1-3H3,(H,23,24,25) |
| InChIKey | ILNDBYVPDUCTMN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |