C12H8F6N2O3 — CID 10925902
(4R)-2-[3,5-bis(trifluoromethyl)phenyl]-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 10925902) has the molecular formula C12H8F6N2O3 and a molecular weight of 342.20 g/mol. Its IUPAC name is (4R)-2-[3,5-bis(trifluoromethyl)phenyl]-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide.
| Compound Name | (4R)-2-[3,5-bis(trifluoromethyl)phenyl]-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 10925902 |
| Molecular Formula | C12H8F6N2O3 |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | (4R)-2-[3,5-bis(trifluoromethyl)phenyl]-N-hydroxy-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NO)[C@H]1COC(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)=N1 |
| InChI | InChI=1S/C12H8F6N2O3/c13-11(14,15)6-1-5(2-7(3-6)12(16,17)18)10-19-8(4-23-10)9(21)20-22/h1-3,8,22H,4H2,(H,20,21)/t8-/m1/s1 |
| InChIKey | STSDGRNFWTWSHW-MRVPVSSYSA-N |
| XLogP | 2.38 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|