C17H20N4O3S — CID 109259509
N-(1,1-dioxothiolan-3-yl)-2-(2-phenylethylamino)pyrimidine-5-carboxamide (PubChem CID 109259509) has the molecular formula C17H20N4O3S and a molecular weight of 360.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-(2-phenylethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-(2-phenylethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109259509 |
| Molecular Formula | C17H20N4O3S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-(2-phenylethylamino)pyrimidine-5-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cnc(NCCc2ccccc2)nc1 |
| InChI | InChI=1S/C17H20N4O3S/c22-16(21-15-7-9-25(23,24)12-15)14-10-19-17(20-11-14)18-8-6-13-4-2-1-3-5-13/h1-5,10-11,15H,6-9,12H2,(H,21,22)(H,18,19,20) |
| InChIKey | KQUABVXAEMPSAQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |