C19H18FN7O — CID 109262279
[2-(2-fluoroanilino)pyrimidin-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109262279) has the molecular formula C19H18FN7O and a molecular weight of 379.40 g/mol. Its IUPAC name is [2-(2-fluoroanilino)pyrimidin-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [2-(2-fluoroanilino)pyrimidin-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109262279 |
| Molecular Formula | C19H18FN7O |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | [2-(2-fluoroanilino)pyrimidin-5-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cnc(Nc2ccccc2F)nc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H18FN7O/c20-15-4-1-2-5-16(15)25-18-23-12-14(13-24-18)17(28)26-8-10-27(11-9-26)19-21-6-3-7-22-19/h1-7,12-13H,8-11H2,(H,23,24,25) |
| InChIKey | HZMWFEAGWQZEHI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |