C18H18FN7 — CID 112899013
N-(2-fluorophenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112899013) has the molecular formula C18H18FN7 and a molecular weight of 351.39 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(2-fluorophenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112899013 |
| Molecular Formula | C18H18FN7 |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-(2-fluorophenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Fc1ccccc1Nc1ccnc(N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C18H18FN7/c19-14-4-1-2-5-15(14)23-16-6-9-22-18(24-16)26-12-10-25(11-13-26)17-20-7-3-8-21-17/h1-9H,10-13H2,(H,22,23,24) |
| InChIKey | SKVZASKZXRTAAL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |