C15H28O7S — CID 10926229
[(2R,3R,4R,5R)-3-acetyloxy-2,4-dimethyl-5-methylsulfonyloxyoctyl] acetate (PubChem CID 10926229) has the molecular formula C15H28O7S and a molecular weight of 352.45 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3-acetyloxy-2,4-dimethyl-5-methylsulfonyloxyoctyl] acetate.
| Compound Name | [(2R,3R,4R,5R)-3-acetyloxy-2,4-dimethyl-5-methylsulfonyloxyoctyl] acetate |
|---|---|
| PubChem CID | 10926229 |
| Molecular Formula | C15H28O7S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [(2R,3R,4R,5R)-3-acetyloxy-2,4-dimethyl-5-methylsulfonyloxyoctyl] acetate |
| SMILES | CCC[C@@H](OS(C)(=O)=O)[C@H](C)[C@H](OC(C)=O)[C@H](C)COC(C)=O |
| InChI | InChI=1S/C15H28O7S/c1-7-8-14(22-23(6,18)19)11(3)15(21-13(5)17)10(2)9-20-12(4)16/h10-11,14-15H,7-9H2,1-6H3/t10-,11+,14-,15-/m1/s1 |
| InChIKey | XEZISDCQIOHDED-BAESOJJISA-N |
| XLogP | 1.90 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|