C15H11F3N4O2 — CID 1092676
[(5R)-5-hydroxy-3-pyridin-4-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-4-ylmethanone (PubChem CID 1092676) has the molecular formula C15H11F3N4O2 and a molecular weight of 336.27 g/mol. Its IUPAC name is [(5R)-5-hydroxy-3-pyridin-4-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [(5R)-5-hydroxy-3-pyridin-4-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 1092676 |
| Molecular Formula | C15H11F3N4O2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | [(5R)-5-hydroxy-3-pyridin-4-yl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-pyridin-4-ylmethanone |
| SMILES | O=C(c1ccncc1)N1N=C(c2ccncc2)C[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C15H11F3N4O2/c16-15(17,18)14(24)9-12(10-1-5-19-6-2-10)21-22(14)13(23)11-3-7-20-8-4-11/h1-8,24H,9H2/t14-/m1/s1 |
| InChIKey | FKFQNGWPYZTHCX-CQSZACIVSA-N |
| XLogP | 1.98 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |