C17H11ClF3IN2O2 — CID 26779191
[(5R)-3-(4-chlorophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-iodophenyl)methanone (PubChem CID 26779191) has the molecular formula C17H11ClF3IN2O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is [(5R)-3-(4-chlorophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-iodophenyl)methanone.
| Compound Name | [(5R)-3-(4-chlorophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 26779191 |
| Molecular Formula | C17H11ClF3IN2O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 493.95 |
| IUPAC Name | [(5R)-3-(4-chlorophenyl)-5-hydroxy-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-iodophenyl)methanone |
| SMILES | O=C(c1ccc(I)cc1)N1N=C(c2ccc(Cl)cc2)C[C@@]1(O)C(F)(F)F |
| InChI | InChI=1S/C17H11ClF3IN2O2/c18-12-5-1-10(2-6-12)14-9-16(26,17(19,20)21)24(23-14)15(25)11-3-7-13(22)8-4-11/h1-8,26H,9H2/t16-/m1/s1 |
| InChIKey | ZBEKRMRREMZJDL-MRXNPFEDSA-N |
| XLogP | 4.45 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|