C12H10F3IN2O2 — CID 615660
[5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-iodophenyl)methanone (PubChem CID 615660) has the molecular formula C12H10F3IN2O2 and a molecular weight of 398.12 g/mol. Its IUPAC name is [5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-iodophenyl)methanone.
| Compound Name | [5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 615660 |
| Molecular Formula | C12H10F3IN2O2 |
| Molecular Weight | 398.12 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | [5-hydroxy-3-methyl-5-(trifluoromethyl)-4H-pyrazol-1-yl]-(4-iodophenyl)methanone |
| SMILES | CC1=NN(C(=O)c2ccc(I)cc2)C(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H10F3IN2O2/c1-7-6-11(20,12(13,14)15)18(17-7)10(19)8-2-4-9(16)5-3-8/h2-5,20H,6H2,1H3 |
| InChIKey | KECCPHVEIVZZDY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.12 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|