C13H11F5N2O2 — CID 126009084
[(5R)-5-hydroxy-3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4H-pyrazol-1-yl]-phenylmethanone (PubChem CID 126009084) has the molecular formula C13H11F5N2O2 and a molecular weight of 322.23 g/mol. Its IUPAC name is [(5R)-5-hydroxy-3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4H-pyrazol-1-yl]-phenylmethanone.
| Compound Name | [(5R)-5-hydroxy-3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4H-pyrazol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 126009084 |
| Molecular Formula | C13H11F5N2O2 |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [(5R)-5-hydroxy-3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-4H-pyrazol-1-yl]-phenylmethanone |
| SMILES | CC1=NN(C(=O)c2ccccc2)[C@](O)(C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C13H11F5N2O2/c1-8-7-11(22,12(14,15)13(16,17)18)20(19-8)10(21)9-5-3-2-4-6-9/h2-6,22H,7H2,1H3/t11-/m1/s1 |
| InChIKey | NRHNSQQAANNIGB-LLVKDONJSA-N |
| XLogP | 2.79 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|