C17H10F13N3O4 — CID 102096275
[5-hydroxy-3-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4H-pyrazol-1-yl]-(4-nitrophenyl)methanone (PubChem CID 102096275) has the molecular formula C17H10F13N3O4 and a molecular weight of 567.26 g/mol. Its IUPAC name is [5-hydroxy-3-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4H-pyrazol-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [5-hydroxy-3-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4H-pyrazol-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 102096275 |
| Molecular Formula | C17H10F13N3O4 |
| Molecular Weight | 567.26 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | [5-hydroxy-3-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-4H-pyrazol-1-yl]-(4-nitrophenyl)methanone |
| SMILES | CC1=NN(C(=O)c2ccc([N+](=O)[O-])cc2)C(O)(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C17H10F13N3O4/c1-7-6-11(35,32(31-7)10(34)8-2-4-9(5-3-8)33(36)37)12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h2-5,35H,6H2,1H3 |
| InChIKey | LQDWGAIRTYSGKA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|